C25H25N7 — CID 153397142
2-[2-naphthalen-2-yl-3-[2-(piperidin-3-ylamino)pyrimidin-4-yl]imidazol-4-yl]propanenitrile (PubChem CID 153397142) has the molecular formula C25H25N7 and a molecular weight of 423.52 g/mol. Its IUPAC name is 2-[2-naphthalen-2-yl-3-[2-(piperidin-3-ylamino)pyrimidin-4-yl]imidazol-4-yl]propanenitrile.
| Compound Name | 2-[2-naphthalen-2-yl-3-[2-(piperidin-3-ylamino)pyrimidin-4-yl]imidazol-4-yl]propanenitrile |
|---|---|
| PubChem CID | 153397142 |
| Molecular Formula | C25H25N7 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 2-[2-naphthalen-2-yl-3-[2-(piperidin-3-ylamino)pyrimidin-4-yl]imidazol-4-yl]propanenitrile |
| SMILES | CC(C#N)c1cnc(-c2ccc3ccccc3c2)n1-c1ccnc(NC2CCCNC2)n1 |
| InChI | InChI=1S/C25H25N7/c1-17(14-26)22-16-29-24(20-9-8-18-5-2-3-6-19(18)13-20)32(22)23-10-12-28-25(31-23)30-21-7-4-11-27-15-21/h2-3,5-6,8-10,12-13,16-17,21,27H,4,7,11,15H2,1H3,(H,28,30,31) |
| InChIKey | MLTVWEGAQULWKR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |