About 6-(3-fluoro-3-methylbutoxy)-1-benzofuran-3-one;(3-fluoro-3-methylbutyl) thiophene-2-carboxylate
6-(3-fluoro-3-methylbutoxy)-1-benzofuran-3-one;(3-fluoro-3-methylbutyl) thiophene-2-carboxylate (PubChem CID 153397326) has the molecular formula C23H28F2O5S
and a molecular weight of 454.54 g/mol. Its IUPAC name is 6-(3-fluoro-3-methylbutoxy)-1-benzofuran-3-one;(3-fluoro-3-methylbutyl) thiophene-2-carboxylate.
Molecular Properties
| Compound Name | 6-(3-fluoro-3-methylbutoxy)-1-benzofuran-3-one;(3-fluoro-3-methylbutyl) thiophene-2-carboxylate |
| PubChem CID | 153397326 |
| Molecular Formula | C23H28F2O5S |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 6-(3-fluoro-3-methylbutoxy)-1-benzofuran-3-one;(3-fluoro-3-methylbutyl) thiophene-2-carboxylate |
| SMILES | CC(C)(F)CCOC(=O)c1cccs1.CC(C)(F)CCOc1ccc2c(c1)OCC2=O |
| InChI | InChI=1S/C13H15FO3.C10H13FO2S/c1-13(2,14)5-6-16-9-3-4-10-11(15)8-17-12(10)7-9;1-10(2,11)5-6-13-9(12)8-4-3-7-14-8/h3-4,7H,5-6,8H2,1-2H3;3-4,7H,5-6H2,1-2H3 |
| InChIKey | DPTFQXHJTCSEHA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(3-fluoro-3-methylbutoxy)-1-benzofuran-3-one;(3-fluoro-3-methylbutyl) thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-fluoro-3-methylbutoxy)-1-benzofuran-3-one;(3-fluoro-3-methylbutyl) thiophene-2-carboxylate?
The IUPAC name of 6-(3-fluoro-3-methylbutoxy)-1-benzofuran-3-one;(3-fluoro-3-methylbutyl) thiophene-2-carboxylate (CID 153397326) is 6-(3-fluoro-3-methylbutoxy)-1-benzofuran-3-one;(3-fluoro-3-methylbutyl) thiophene-2-carboxylate.
What is the SMILES notation for 6-(3-fluoro-3-methylbutoxy)-1-benzofuran-3-one;(3-fluoro-3-methylbutyl) thiophene-2-carboxylate?
The canonical SMILES for 6-(3-fluoro-3-methylbutoxy)-1-benzofuran-3-one;(3-fluoro-3-methylbutyl) thiophene-2-carboxylate is CC(C)(F)CCOC(=O)c1cccs1.CC(C)(F)CCOc1ccc2c(c1)OCC2=O.
What is the InChIKey of 6-(3-fluoro-3-methylbutoxy)-1-benzofuran-3-one;(3-fluoro-3-methylbutyl) thiophene-2-carboxylate?
The InChIKey is DPTFQXHJTCSEHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FO3.C10H13FO2S/c1-13(2,14)5-6-16-9-3-4-10-11(15)8-17-12(10)7-9;1-10(2,11)5-6-13-9(12)8-4-3-7-14-8/h3-4,7H,5-6,8H2,1-2H3;3-4,7H,5-6H2,1-2H3.
What are the key properties of 6-(3-fluoro-3-methylbutoxy)-1-benzofuran-3-one;(3-fluoro-3-methylbutyl) thiophene-2-carboxylate?
6-(3-fluoro-3-methylbutoxy)-1-benzofuran-3-one;(3-fluoro-3-methylbutyl) thiophene-2-carboxylate has a molecular weight of 454.54 g/mol, XLogP of 5.82, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-fluoro-3-methylbutoxy)-1-benzofuran-3-one;(3-fluoro-3-methylbutyl) thiophene-2-carboxylate is sourced from PubChem (CID 153397326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).