About 6-(1-fluoroethyl)-7-(4-methoxybut-1-enyl)-2-methyl-2,5-dihydro-1H-azepine
6-(1-fluoroethyl)-7-(4-methoxybut-1-enyl)-2-methyl-2,5-dihydro-1H-azepine (PubChem CID 153397408) has the molecular formula C14H22FNO
and a molecular weight of 239.33 g/mol. Its IUPAC name is 6-(1-fluoroethyl)-7-(4-methoxybut-1-enyl)-2-methyl-2,5-dihydro-1H-azepine.
Molecular Properties
| Compound Name | 6-(1-fluoroethyl)-7-(4-methoxybut-1-enyl)-2-methyl-2,5-dihydro-1H-azepine |
| PubChem CID | 153397408 |
| Molecular Formula | C14H22FNO |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 6-(1-fluoroethyl)-7-(4-methoxybut-1-enyl)-2-methyl-2,5-dihydro-1H-azepine |
| SMILES | COCCC=CC1=C(C(C)F)CC=CC(C)N1 |
| InChI | InChI=1S/C14H22FNO/c1-11-7-6-8-13(12(2)15)14(16-11)9-4-5-10-17-3/h4,6-7,9,11-12,16H,5,8,10H2,1-3H3 |
| InChIKey | UJONKORCUMHVRH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(1-fluoroethyl)-7-(4-methoxybut-1-enyl)-2-methyl-2,5-dihydro-1H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-fluoroethyl)-7-(4-methoxybut-1-enyl)-2-methyl-2,5-dihydro-1H-azepine?
The IUPAC name of 6-(1-fluoroethyl)-7-(4-methoxybut-1-enyl)-2-methyl-2,5-dihydro-1H-azepine (CID 153397408) is 6-(1-fluoroethyl)-7-(4-methoxybut-1-enyl)-2-methyl-2,5-dihydro-1H-azepine.
What is the SMILES notation for 6-(1-fluoroethyl)-7-(4-methoxybut-1-enyl)-2-methyl-2,5-dihydro-1H-azepine?
The canonical SMILES for 6-(1-fluoroethyl)-7-(4-methoxybut-1-enyl)-2-methyl-2,5-dihydro-1H-azepine is COCCC=CC1=C(C(C)F)CC=CC(C)N1.
What is the InChIKey of 6-(1-fluoroethyl)-7-(4-methoxybut-1-enyl)-2-methyl-2,5-dihydro-1H-azepine?
The InChIKey is UJONKORCUMHVRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22FNO/c1-11-7-6-8-13(12(2)15)14(16-11)9-4-5-10-17-3/h4,6-7,9,11-12,16H,5,8,10H2,1-3H3.
What are the key properties of 6-(1-fluoroethyl)-7-(4-methoxybut-1-enyl)-2-methyl-2,5-dihydro-1H-azepine?
6-(1-fluoroethyl)-7-(4-methoxybut-1-enyl)-2-methyl-2,5-dihydro-1H-azepine has a molecular weight of 239.33 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-fluoroethyl)-7-(4-methoxybut-1-enyl)-2-methyl-2,5-dihydro-1H-azepine is sourced from PubChem (CID 153397408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).