About 1-[(3,4-dimethoxyphenyl)-difluoromethyl]-6,7-dimethoxyisoquinoline
1-[(3,4-dimethoxyphenyl)-difluoromethyl]-6,7-dimethoxyisoquinoline (PubChem CID 153397725) has the molecular formula C20H19F2NO4
and a molecular weight of 375.37 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)-difluoromethyl]-6,7-dimethoxyisoquinoline.
Molecular Properties
| Compound Name | 1-[(3,4-dimethoxyphenyl)-difluoromethyl]-6,7-dimethoxyisoquinoline |
| PubChem CID | 153397725 |
| Molecular Formula | C20H19F2NO4 |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)-difluoromethyl]-6,7-dimethoxyisoquinoline |
| SMILES | COc1ccc(C(F)(F)c2nccc3cc(OC)c(OC)cc23)cc1OC |
| InChI | InChI=1S/C20H19F2NO4/c1-24-15-6-5-13(10-17(15)26-3)20(21,22)19-14-11-18(27-4)16(25-2)9-12(14)7-8-23-19/h5-11H,1-4H3 |
| InChIKey | GOECDACQAXXPMY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3,4-dimethoxyphenyl)-difluoromethyl]-6,7-dimethoxyisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-dimethoxyphenyl)-difluoromethyl]-6,7-dimethoxyisoquinoline?
The IUPAC name of 1-[(3,4-dimethoxyphenyl)-difluoromethyl]-6,7-dimethoxyisoquinoline (CID 153397725) is 1-[(3,4-dimethoxyphenyl)-difluoromethyl]-6,7-dimethoxyisoquinoline.
What is the SMILES notation for 1-[(3,4-dimethoxyphenyl)-difluoromethyl]-6,7-dimethoxyisoquinoline?
The canonical SMILES for 1-[(3,4-dimethoxyphenyl)-difluoromethyl]-6,7-dimethoxyisoquinoline is COc1ccc(C(F)(F)c2nccc3cc(OC)c(OC)cc23)cc1OC.
What is the InChIKey of 1-[(3,4-dimethoxyphenyl)-difluoromethyl]-6,7-dimethoxyisoquinoline?
The InChIKey is GOECDACQAXXPMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F2NO4/c1-24-15-6-5-13(10-17(15)26-3)20(21,22)19-14-11-18(27-4)16(25-2)9-12(14)7-8-23-19/h5-11H,1-4H3.
What are the key properties of 1-[(3,4-dimethoxyphenyl)-difluoromethyl]-6,7-dimethoxyisoquinoline?
1-[(3,4-dimethoxyphenyl)-difluoromethyl]-6,7-dimethoxyisoquinoline has a molecular weight of 375.37 g/mol, XLogP of 4.41, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-dimethoxyphenyl)-difluoromethyl]-6,7-dimethoxyisoquinoline is sourced from PubChem (CID 153397725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).