C14H18F2N5O3+ — CID 153397998
N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-1-oxo-2,3,5,6,8,8a-hexahydroimidazo[1,2-a]pyrazin-1-ium-7-carboxamide (PubChem CID 153397998) has the molecular formula C14H18F2N5O3+ and a molecular weight of 342.33 g/mol. Its IUPAC name is N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-1-oxo-2,3,5,6,8,8a-hexahydroimidazo[1,2-a]pyrazin-1-ium-7-carboxamide.
| Compound Name | N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-1-oxo-2,3,5,6,8,8a-hexahydroimidazo[1,2-a]pyrazin-1-ium-7-carboxamide |
|---|---|
| PubChem CID | 153397998 |
| Molecular Formula | C14H18F2N5O3+ |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-1-oxo-2,3,5,6,8,8a-hexahydroimidazo[1,2-a]pyrazin-1-ium-7-carboxamide |
| SMILES | O=C(Nc1cc(F)c(=O)n(CCF)c1)N1CCN2CC[N+](=O)C2C1 |
| InChI | InChI=1S/C14H17F2N5O3/c15-1-2-19-8-10(7-11(16)13(19)22)17-14(23)20-4-3-18-5-6-21(24)12(18)9-20/h7-8,12H,1-6,9H2/p+1 |
| InChIKey | NLGPOHQHJFPCEU-UHFFFAOYSA-O |
| XLogP | 0.22 |
| TPSA | 77.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|