C23H31F3N4O2 — CID 153398011
N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1-pentyl-4-(2-piperidin-4-ylethynyl)azetidine-2-carboxamide (PubChem CID 153398011) has the molecular formula C23H31F3N4O2 and a molecular weight of 452.52 g/mol. Its IUPAC name is N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1-pentyl-4-(2-piperidin-4-ylethynyl)azetidine-2-carboxamide.
| Compound Name | N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1-pentyl-4-(2-piperidin-4-ylethynyl)azetidine-2-carboxamide |
|---|---|
| PubChem CID | 153398011 |
| Molecular Formula | C23H31F3N4O2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]-1-pentyl-4-(2-piperidin-4-ylethynyl)azetidine-2-carboxamide |
| SMILES | CCCCCN1C(C#CC2CCNCC2)CC1C(=O)Nc1cc(F)c(=O)n(CC(F)F)c1 |
| InChI | InChI=1S/C23H31F3N4O2/c1-2-3-4-11-30-18(6-5-16-7-9-27-10-8-16)13-20(30)22(31)28-17-12-19(24)23(32)29(14-17)15-21(25)26/h12,14,16,18,20-21,27H,2-4,7-11,13,15H2,1H3,(H,28,31) |
| InChIKey | NXOSYZVJWLEXSG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|