C14H20N5O3+ — CID 153398110
N-(1-ethyl-6-oxo-3-pyridinyl)-1-oxo-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyrimidin-1-ium-3-carboxamide (PubChem CID 153398110) has the molecular formula C14H20N5O3+ and a molecular weight of 306.35 g/mol. Its IUPAC name is N-(1-ethyl-6-oxo-3-pyridinyl)-1-oxo-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyrimidin-1-ium-3-carboxamide.
| Compound Name | N-(1-ethyl-6-oxo-3-pyridinyl)-1-oxo-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyrimidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 153398110 |
| Molecular Formula | C14H20N5O3+ |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-(1-ethyl-6-oxo-3-pyridinyl)-1-oxo-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyrimidin-1-ium-3-carboxamide |
| SMILES | CCn1cc(NC(=O)C2C[N+](=O)C3NCCCN23)ccc1=O |
| InChI | InChI=1S/C14H19N5O3/c1-2-17-8-10(4-5-12(17)20)16-13(21)11-9-19(22)14-15-6-3-7-18(11)14/h4-5,8,11,14-15H,2-3,6-7,9H2,1H3/p+1 |
| InChIKey | XQUXWAJPEIDYFB-UHFFFAOYSA-O |
| XLogP | -0.45 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|