C9H10F2N2O2 — CID 153398186
N-[1-(2,2-difluoroethyl)-5-methyl-6-oxo-3-pyridinyl]formamide (PubChem CID 153398186) has the molecular formula C9H10F2N2O2 and a molecular weight of 216.19 g/mol. Its IUPAC name is N-[1-(2,2-difluoroethyl)-5-methyl-6-oxo-3-pyridinyl]formamide.
| Compound Name | N-[1-(2,2-difluoroethyl)-5-methyl-6-oxo-3-pyridinyl]formamide |
|---|---|
| PubChem CID | 153398186 |
| Molecular Formula | C9H10F2N2O2 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | N-[1-(2,2-difluoroethyl)-5-methyl-6-oxo-3-pyridinyl]formamide |
| SMILES | Cc1cc(NC=O)cn(CC(F)F)c1=O |
| InChI | InChI=1S/C9H10F2N2O2/c1-6-2-7(12-5-14)3-13(9(6)15)4-8(10)11/h2-3,5,8H,4H2,1H3,(H,12,14) |
| InChIKey | DDNJVSJTNGDBTG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|