C18H35N3O2 — CID 153398530
ethane;2-[2-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl-methylamino]ethyl-methylamino]-N-methylacetamide (PubChem CID 153398530) has the molecular formula C18H35N3O2 and a molecular weight of 325.50 g/mol. Its IUPAC name is ethane;2-[2-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl-methylamino]ethyl-methylamino]-N-methylacetamide.
| Compound Name | ethane;2-[2-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl-methylamino]ethyl-methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 153398530 |
| Molecular Formula | C18H35N3O2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.27 |
| IUPAC Name | ethane;2-[2-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl-methylamino]ethyl-methylamino]-N-methylacetamide |
| SMILES | C=C/C=C\C(=C)OCCCN(C)CCN(C)CC(=O)NC.CC |
| InChI | InChI=1S/C16H29N3O2.C2H6/c1-6-7-9-15(2)21-13-8-10-18(4)11-12-19(5)14-16(20)17-3;1-2/h6-7,9H,1-2,8,10-14H2,3-5H3,(H,17,20);1-2H3/b9-7-; |
| InChIKey | AYKHEHBICZHUOW-VILQZVERSA-N |
| XLogP | 2.28 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|