C20H22N3O3+ — CID 153398749
6,20-diethyl-2,9,17-trioxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaene (PubChem CID 153398749) has the molecular formula C20H22N3O3+ and a molecular weight of 352.41 g/mol. Its IUPAC name is 6,20-diethyl-2,9,17-trioxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaene.
| Compound Name | 6,20-diethyl-2,9,17-trioxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaene |
|---|---|
| PubChem CID | 153398749 |
| Molecular Formula | C20H22N3O3+ |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 6,20-diethyl-2,9,17-trioxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaene |
| SMILES | CCN1CCOc2cc3c(cc21)Oc1cc2c(cc1=N3)OCC[N+]=2CC |
| InChI | InChI=1S/C20H22N3O3/c1-3-22-5-7-24-19-9-13-17(11-15(19)22)26-18-12-16-20(10-14(18)21-13)25-8-6-23(16)4-2/h9-12H,3-8H2,1-2H3/q+1 |
| InChIKey | AHVLQJWFEAPYNA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|