C24H29ClN2O4 — CID 153398825
(10-acetyloxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl) 4-aminobutanoate;chloromethane (PubChem CID 153398825) has the molecular formula C24H29ClN2O4 and a molecular weight of 444.96 g/mol. Its IUPAC name is (10-acetyloxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl) 4-aminobutanoate;chloromethane.
| Compound Name | (10-acetyloxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl) 4-aminobutanoate;chloromethane |
|---|---|
| PubChem CID | 153398825 |
| Molecular Formula | C24H29ClN2O4 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | (10-acetyloxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl) 4-aminobutanoate;chloromethane |
| SMILES | CC(=O)Oc1ccc2c(c1OC(=O)CCCN)-c1cccc3c1C(C2)N(C)CC3.CCl |
| InChI | InChI=1S/C23H26N2O4.CH3Cl/c1-14(26)28-19-9-8-16-13-18-21-15(10-12-25(18)2)5-3-6-17(21)22(16)23(19)29-20(27)7-4-11-24;1-2/h3,5-6,8-9,18H,4,7,10-13,24H2,1-2H3;1H3 |
| InChIKey | VJKQGAQOOCBBQI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|