C20H23NO3 — CID 153398831
ethane;(11-hydroxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl) acetate (PubChem CID 153398831) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is ethane;(11-hydroxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl) acetate.
| Compound Name | ethane;(11-hydroxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl) acetate |
|---|---|
| PubChem CID | 153398831 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | ethane;(11-hydroxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl) acetate |
| SMILES | CC.CC(=O)Oc1ccc2c(c1O)-c1cccc3c1C(C2)NCC3 |
| InChI | InChI=1S/C18H17NO3.C2H6/c1-10(20)22-15-6-5-12-9-14-16-11(7-8-19-14)3-2-4-13(16)17(12)18(15)21;1-2/h2-6,14,19,21H,7-9H2,1H3;1-2H3 |
| InChIKey | AXBKXQFOAPVWDC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|