C22H22N4O2S — CID 153398906
5-[2-methyl-6-[(4-methylphenyl)sulfanyloxymethyl]morpholin-4-yl]-1,7-naphthyridine-8-carbonitrile (PubChem CID 153398906) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is 5-[2-methyl-6-[(4-methylphenyl)sulfanyloxymethyl]morpholin-4-yl]-1,7-naphthyridine-8-carbonitrile.
| Compound Name | 5-[2-methyl-6-[(4-methylphenyl)sulfanyloxymethyl]morpholin-4-yl]-1,7-naphthyridine-8-carbonitrile |
|---|---|
| PubChem CID | 153398906 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 5-[2-methyl-6-[(4-methylphenyl)sulfanyloxymethyl]morpholin-4-yl]-1,7-naphthyridine-8-carbonitrile |
| SMILES | Cc1ccc(SOCC2CN(c3cnc(C#N)c4ncccc34)CC(C)O2)cc1 |
| InChI | InChI=1S/C22H22N4O2S/c1-15-5-7-18(8-6-15)29-27-14-17-13-26(12-16(2)28-17)21-11-25-20(10-23)22-19(21)4-3-9-24-22/h3-9,11,16-17H,12-14H2,1-2H3 |
| InChIKey | VPDORKZYBNMNLU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 71.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|