C11H23FN2O — CID 153399046
ethane;N-[(3-fluoropyrrolidin-3-yl)methyl]-2-methylpropanamide (PubChem CID 153399046) has the molecular formula C11H23FN2O and a molecular weight of 218.32 g/mol. Its IUPAC name is ethane;N-[(3-fluoropyrrolidin-3-yl)methyl]-2-methylpropanamide.
| Compound Name | ethane;N-[(3-fluoropyrrolidin-3-yl)methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 153399046 |
| Molecular Formula | C11H23FN2O |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | ethane;N-[(3-fluoropyrrolidin-3-yl)methyl]-2-methylpropanamide |
| SMILES | CC.CC(C)C(=O)NCC1(F)CCNC1 |
| InChI | InChI=1S/C9H17FN2O.C2H6/c1-7(2)8(13)12-6-9(10)3-4-11-5-9;1-2/h7,11H,3-6H2,1-2H3,(H,12,13);1-2H3 |
| InChIKey | PKORUFHMAYVVEL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |