C28H33N5O5S — CID 153399809
7-[5-(7-methoxy-2-methylquinolin-6-yl)-1,3-oxazol-2-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;1-sulfanylazetidine-3-carboxamide (PubChem CID 153399809) has the molecular formula C28H33N5O5S and a molecular weight of 551.67 g/mol. Its IUPAC name is 7-[5-(7-methoxy-2-methylquinolin-6-yl)-1,3-oxazol-2-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;1-sulfanylazetidine-3-carboxamide.
| Compound Name | 7-[5-(7-methoxy-2-methylquinolin-6-yl)-1,3-oxazol-2-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;1-sulfanylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 153399809 |
| Molecular Formula | C28H33N5O5S |
| Molecular Weight | 551.67 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | 7-[5-(7-methoxy-2-methylquinolin-6-yl)-1,3-oxazol-2-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;1-sulfanylazetidine-3-carboxamide |
| SMILES | COc1cc2nc(C)ccc2cc1-c1cnc(CCCCCCC(=O)c2ccon2)o1.NC(=O)C1CN(S)C1 |
| InChI | InChI=1S/C24H25N3O4.C4H8N2OS/c1-16-9-10-17-13-18(22(29-2)14-20(17)26-16)23-15-25-24(31-23)8-6-4-3-5-7-21(28)19-11-12-30-27-19;5-4(7)3-1-6(8)2-3/h9-15H,3-8H2,1-2H3;3,8H,1-2H2,(H2,5,7) |
| InChIKey | MTPBZUCDXJNOBP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 137.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.67 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|