About 7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;N-methylmethanamine
7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;N-methylmethanamine (PubChem CID 153399898) has the molecular formula C21H26FN3O3
and a molecular weight of 387.46 g/mol. Its IUPAC name is 7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;N-methylmethanamine.
Molecular Properties
| Compound Name | 7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;N-methylmethanamine |
| PubChem CID | 153399898 |
| Molecular Formula | C21H26FN3O3 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;N-methylmethanamine |
| SMILES | CNC.O=C(CCCCCCc1cc(-c2ccc(F)cc2)on1)c1ccon1 |
| InChI | InChI=1S/C19H19FN2O3.C2H7N/c20-15-9-7-14(8-10-15)19-13-16(21-25-19)5-3-1-2-4-6-18(23)17-11-12-24-22-17;1-3-2/h7-13H,1-6H2;3H,1-2H3 |
| InChIKey | YSSQPWJBPPXUJT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;N-methylmethanamine?
The IUPAC name of 7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;N-methylmethanamine (CID 153399898) is 7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;N-methylmethanamine.
What is the SMILES notation for 7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;N-methylmethanamine?
The canonical SMILES for 7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;N-methylmethanamine is CNC.O=C(CCCCCCc1cc(-c2ccc(F)cc2)on1)c1ccon1.
What is the InChIKey of 7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;N-methylmethanamine?
The InChIKey is YSSQPWJBPPXUJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FN2O3.C2H7N/c20-15-9-7-14(8-10-15)19-13-16(21-25-19)5-3-1-2-4-6-18(23)17-11-12-24-22-17;1-3-2/h7-13H,1-6H2;3H,1-2H3.
What are the key properties of 7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;N-methylmethanamine?
7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;N-methylmethanamine has a molecular weight of 387.46 g/mol, XLogP of 4.68, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;N-methylmethanamine is sourced from PubChem (CID 153399898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).