About 7-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;formonitrile
7-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;formonitrile (PubChem CID 153399969) has the molecular formula C20H20FN3O3
and a molecular weight of 369.40 g/mol. Its IUPAC name is 7-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;formonitrile.
Molecular Properties
| Compound Name | 7-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;formonitrile |
| PubChem CID | 153399969 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 7-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;formonitrile |
| SMILES | C#N.O=C(CCCCCCc1cc(-c2ccccc2F)on1)c1ccon1 |
| InChI | InChI=1S/C19H19FN2O3.CHN/c20-16-9-6-5-8-15(16)19-13-14(21-25-19)7-3-1-2-4-10-18(23)17-11-12-24-22-17;1-2/h5-6,8-9,11-13H,1-4,7,10H2;1H |
| InChIKey | GIUIYYRQPIDQMB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 92.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;formonitrile?
The IUPAC name of 7-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;formonitrile (CID 153399969) is 7-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;formonitrile.
What is the SMILES notation for 7-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;formonitrile?
The canonical SMILES for 7-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;formonitrile is C#N.O=C(CCCCCCc1cc(-c2ccccc2F)on1)c1ccon1.
What is the InChIKey of 7-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;formonitrile?
The InChIKey is GIUIYYRQPIDQMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FN2O3.CHN/c20-16-9-6-5-8-15(16)19-13-14(21-25-19)7-3-1-2-4-10-18(23)17-11-12-24-22-17;1-2/h5-6,8-9,11-13H,1-4,7,10H2;1H.
What are the key properties of 7-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;formonitrile?
7-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;formonitrile has a molecular weight of 369.40 g/mol, XLogP of 4.98, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-1-(1,2-oxazol-3-yl)heptan-1-one;formonitrile is sourced from PubChem (CID 153399969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).