C26H28N4O3 — CID 153400014
7-methoxy-1-methyl-6-[2-[7-(1,3-oxazol-2-yl)nona-7,8-dienyl]-1H-imidazol-5-yl]quinolin-2-one (PubChem CID 153400014) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 7-methoxy-1-methyl-6-[2-[7-(1,3-oxazol-2-yl)nona-7,8-dienyl]-1H-imidazol-5-yl]quinolin-2-one.
| Compound Name | 7-methoxy-1-methyl-6-[2-[7-(1,3-oxazol-2-yl)nona-7,8-dienyl]-1H-imidazol-5-yl]quinolin-2-one |
|---|---|
| PubChem CID | 153400014 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 7-methoxy-1-methyl-6-[2-[7-(1,3-oxazol-2-yl)nona-7,8-dienyl]-1H-imidazol-5-yl]quinolin-2-one |
| SMILES | C=C=C(CCCCCCc1ncc(-c2cc3ccc(=O)n(C)c3cc2OC)[nH]1)c1ncco1 |
| InChI | InChI=1S/C26H28N4O3/c1-4-18(26-27-13-14-33-26)9-7-5-6-8-10-24-28-17-21(29-24)20-15-19-11-12-25(31)30(2)22(19)16-23(20)32-3/h11-17H,1,5-10H2,2-3H3,(H,28,29) |
| InChIKey | WKKQMWZCKVDRLZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|