C20H16F12O2Sn — CID 15340033
2-[[diphenyl-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]stannyl]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 15340033) has the molecular formula C20H16F12O2Sn and a molecular weight of 635.03 g/mol. Its IUPAC name is 2-[[diphenyl-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]stannyl]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[[diphenyl-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]stannyl]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 15340033 |
| Molecular Formula | C20H16F12O2Sn |
| Molecular Weight | 635.03 g/mol |
| Exact Mass | 636.00 |
| IUPAC Name | 2-[[diphenyl-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]stannyl]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(C[Sn](CC(O)(C(F)(F)F)C(F)(F)F)(c1ccccc1)c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/2C6H5.2C4H3F6O.Sn/c2*1-2-4-6-5-3-1;2*1-2(11,3(5,6)7)4(8,9)10;/h2*1-5H;2*11H,1H2; |
| InChIKey | UUOOLZOASJCRBW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.03 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |