About 3-hydroxy-N'-methyl-N-propylidenepropanimidamide
3-hydroxy-N'-methyl-N-propylidenepropanimidamide (PubChem CID 153400535) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 3-hydroxy-N'-methyl-N-propylidenepropanimidamide.
Molecular Properties
| Compound Name | 3-hydroxy-N'-methyl-N-propylidenepropanimidamide |
| PubChem CID | 153400535 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 3-hydroxy-N'-methyl-N-propylidenepropanimidamide |
| SMILES | CC/C=N/C(CCO)=N/C |
| InChI | InChI=1S/C7H14N2O/c1-3-5-9-7(8-2)4-6-10/h5,10H,3-4,6H2,1-2H3/b8-7+,9-5+ |
| InChIKey | ZVSFNXQCDKQODL-DMQCZMPNSA-N |
| XLogP | 0.88 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-N'-methyl-N-propylidenepropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-N'-methyl-N-propylidenepropanimidamide?
The IUPAC name of 3-hydroxy-N'-methyl-N-propylidenepropanimidamide (CID 153400535) is 3-hydroxy-N'-methyl-N-propylidenepropanimidamide.
What is the SMILES notation for 3-hydroxy-N'-methyl-N-propylidenepropanimidamide?
The canonical SMILES for 3-hydroxy-N'-methyl-N-propylidenepropanimidamide is CC/C=N/C(CCO)=N/C.
What is the InChIKey of 3-hydroxy-N'-methyl-N-propylidenepropanimidamide?
The InChIKey is ZVSFNXQCDKQODL-DMQCZMPNSA-N. The full InChI is InChI=1S/C7H14N2O/c1-3-5-9-7(8-2)4-6-10/h5,10H,3-4,6H2,1-2H3/b8-7+,9-5+.
What are the key properties of 3-hydroxy-N'-methyl-N-propylidenepropanimidamide?
3-hydroxy-N'-methyl-N-propylidenepropanimidamide has a molecular weight of 142.20 g/mol, XLogP of 0.88, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-N'-methyl-N-propylidenepropanimidamide is sourced from PubChem (CID 153400535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).