About 1,6-diazabicyclo[3.2.1]octan-7-one;phenylmethanol;trifluoro(methoxy)methane
1,6-diazabicyclo[3.2.1]octan-7-one;phenylmethanol;trifluoro(methoxy)methane (PubChem CID 153400927) has the molecular formula C15H21F3N2O3
and a molecular weight of 334.34 g/mol. Its IUPAC name is 1,6-diazabicyclo[3.2.1]octan-7-one;phenylmethanol;trifluoro(methoxy)methane.
Molecular Properties
| Compound Name | 1,6-diazabicyclo[3.2.1]octan-7-one;phenylmethanol;trifluoro(methoxy)methane |
| PubChem CID | 153400927 |
| Molecular Formula | C15H21F3N2O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1,6-diazabicyclo[3.2.1]octan-7-one;phenylmethanol;trifluoro(methoxy)methane |
| SMILES | COC(F)(F)F.O=C1NC2CCCN1C2.OCc1ccccc1 |
| InChI | InChI=1S/C7H8O.C6H10N2O.C2H3F3O/c8-6-7-4-2-1-3-5-7;9-6-7-5-2-1-3-8(6)4-5;1-6-2(3,4)5/h1-5,8H,6H2;5H,1-4H2,(H,7,9);1H3 |
| InChIKey | XUWHZUHJHUMVGX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,6-diazabicyclo[3.2.1]octan-7-one;phenylmethanol;trifluoro(methoxy)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-diazabicyclo[3.2.1]octan-7-one;phenylmethanol;trifluoro(methoxy)methane?
The IUPAC name of 1,6-diazabicyclo[3.2.1]octan-7-one;phenylmethanol;trifluoro(methoxy)methane (CID 153400927) is 1,6-diazabicyclo[3.2.1]octan-7-one;phenylmethanol;trifluoro(methoxy)methane.
What is the SMILES notation for 1,6-diazabicyclo[3.2.1]octan-7-one;phenylmethanol;trifluoro(methoxy)methane?
The canonical SMILES for 1,6-diazabicyclo[3.2.1]octan-7-one;phenylmethanol;trifluoro(methoxy)methane is COC(F)(F)F.O=C1NC2CCCN1C2.OCc1ccccc1.
What is the InChIKey of 1,6-diazabicyclo[3.2.1]octan-7-one;phenylmethanol;trifluoro(methoxy)methane?
The InChIKey is XUWHZUHJHUMVGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H10N2O.C2H3F3O/c8-6-7-4-2-1-3-5-7;9-6-7-5-2-1-3-8(6)4-5;1-6-2(3,4)5/h1-5,8H,6H2;5H,1-4H2,(H,7,9);1H3.
What are the key properties of 1,6-diazabicyclo[3.2.1]octan-7-one;phenylmethanol;trifluoro(methoxy)methane?
1,6-diazabicyclo[3.2.1]octan-7-one;phenylmethanol;trifluoro(methoxy)methane has a molecular weight of 334.34 g/mol, XLogP of 2.51, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-diazabicyclo[3.2.1]octan-7-one;phenylmethanol;trifluoro(methoxy)methane is sourced from PubChem (CID 153400927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).