About (2S,5R)-2-(1,1-difluoroethyl)-6-phenylmethoxy-6-aza-1-azoniabicyclo[3.2.1]oct-1(7)-en-7-ol
(2S,5R)-2-(1,1-difluoroethyl)-6-phenylmethoxy-6-aza-1-azoniabicyclo[3.2.1]oct-1(7)-en-7-ol (PubChem CID 153400928) has the molecular formula C15H19F2N2O2+
and a molecular weight of 297.32 g/mol. Its IUPAC name is (2S,5R)-2-(1,1-difluoroethyl)-6-phenylmethoxy-6-aza-1-azoniabicyclo[3.2.1]oct-1(7)-en-7-ol.
Molecular Properties
| Compound Name | (2S,5R)-2-(1,1-difluoroethyl)-6-phenylmethoxy-6-aza-1-azoniabicyclo[3.2.1]oct-1(7)-en-7-ol |
| PubChem CID | 153400928 |
| Molecular Formula | C15H19F2N2O2+ |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (2S,5R)-2-(1,1-difluoroethyl)-6-phenylmethoxy-6-aza-1-azoniabicyclo[3.2.1]oct-1(7)-en-7-ol |
| SMILES | CC(F)(F)[C@@H]1CC[C@@H]2C[N+]1=C(O)N2OCc1ccccc1 |
| InChI | InChI=1S/C15H18F2N2O2/c1-15(16,17)13-8-7-12-9-18(13)14(20)19(12)21-10-11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3/p+1/t12-,13+/m1/s1 |
| InChIKey | BKYHGEDJBROPAA-OLZOCXBDSA-O |
| XLogP | 2.55 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (2S,5R)-2-(1,1-difluoroethyl)-6-phenylmethoxy-6-aza-1-azoniabicyclo[3.2.1]oct-1(7)-en-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-2-(1,1-difluoroethyl)-6-phenylmethoxy-6-aza-1-azoniabicyclo[3.2.1]oct-1(7)-en-7-ol?
The IUPAC name of (2S,5R)-2-(1,1-difluoroethyl)-6-phenylmethoxy-6-aza-1-azoniabicyclo[3.2.1]oct-1(7)-en-7-ol (CID 153400928) is (2S,5R)-2-(1,1-difluoroethyl)-6-phenylmethoxy-6-aza-1-azoniabicyclo[3.2.1]oct-1(7)-en-7-ol.
What is the SMILES notation for (2S,5R)-2-(1,1-difluoroethyl)-6-phenylmethoxy-6-aza-1-azoniabicyclo[3.2.1]oct-1(7)-en-7-ol?
The canonical SMILES for (2S,5R)-2-(1,1-difluoroethyl)-6-phenylmethoxy-6-aza-1-azoniabicyclo[3.2.1]oct-1(7)-en-7-ol is CC(F)(F)[C@@H]1CC[C@@H]2C[N+]1=C(O)N2OCc1ccccc1.
What is the InChIKey of (2S,5R)-2-(1,1-difluoroethyl)-6-phenylmethoxy-6-aza-1-azoniabicyclo[3.2.1]oct-1(7)-en-7-ol?
The InChIKey is BKYHGEDJBROPAA-OLZOCXBDSA-O. The full InChI is InChI=1S/C15H18F2N2O2/c1-15(16,17)13-8-7-12-9-18(13)14(20)19(12)21-10-11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3/p+1/t12-,13+/m1/s1.
What are the key properties of (2S,5R)-2-(1,1-difluoroethyl)-6-phenylmethoxy-6-aza-1-azoniabicyclo[3.2.1]oct-1(7)-en-7-ol?
(2S,5R)-2-(1,1-difluoroethyl)-6-phenylmethoxy-6-aza-1-azoniabicyclo[3.2.1]oct-1(7)-en-7-ol has a molecular weight of 297.32 g/mol, XLogP of 2.55, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-2-(1,1-difluoroethyl)-6-phenylmethoxy-6-aza-1-azoniabicyclo[3.2.1]oct-1(7)-en-7-ol is sourced from PubChem (CID 153400928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).