About benzyl(triphenyl)azanium;4-[bis(4-hydroxyphenyl)methyl]phenolate
benzyl(triphenyl)azanium;4-[bis(4-hydroxyphenyl)methyl]phenolate (PubChem CID 153401488) has the molecular formula C44H37NO3
and a molecular weight of 627.78 g/mol. Its IUPAC name is benzyl(triphenyl)azanium;4-[bis(4-hydroxyphenyl)methyl]phenolate.
Molecular Properties
| Compound Name | benzyl(triphenyl)azanium;4-[bis(4-hydroxyphenyl)methyl]phenolate |
| PubChem CID | 153401488 |
| Molecular Formula | C44H37NO3 |
| Molecular Weight | 627.78 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | benzyl(triphenyl)azanium;4-[bis(4-hydroxyphenyl)methyl]phenolate |
| SMILES | [O-]c1ccc(C(c2ccc(O)cc2)c2ccc(O)cc2)cc1.c1ccc(C[N+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N.C19H16O3/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15/h1-20H,21H2;1-12,19-22H/q+1;/p-1 |
| InChIKey | ZGBYYUCGORFONO-UHFFFAOYSA-M |
| XLogP | 10.21 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 627.78 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze benzyl(triphenyl)azanium;4-[bis(4-hydroxyphenyl)methyl]phenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(triphenyl)azanium;4-[bis(4-hydroxyphenyl)methyl]phenolate?
The IUPAC name of benzyl(triphenyl)azanium;4-[bis(4-hydroxyphenyl)methyl]phenolate (CID 153401488) is benzyl(triphenyl)azanium;4-[bis(4-hydroxyphenyl)methyl]phenolate.
What is the SMILES notation for benzyl(triphenyl)azanium;4-[bis(4-hydroxyphenyl)methyl]phenolate?
The canonical SMILES for benzyl(triphenyl)azanium;4-[bis(4-hydroxyphenyl)methyl]phenolate is [O-]c1ccc(C(c2ccc(O)cc2)c2ccc(O)cc2)cc1.c1ccc(C[N+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzyl(triphenyl)azanium;4-[bis(4-hydroxyphenyl)methyl]phenolate?
The InChIKey is ZGBYYUCGORFONO-UHFFFAOYSA-M. The full InChI is InChI=1S/C25H22N.C19H16O3/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15/h1-20H,21H2;1-12,19-22H/q+1;/p-1.
What are the key properties of benzyl(triphenyl)azanium;4-[bis(4-hydroxyphenyl)methyl]phenolate?
benzyl(triphenyl)azanium;4-[bis(4-hydroxyphenyl)methyl]phenolate has a molecular weight of 627.78 g/mol, XLogP of 10.21, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(triphenyl)azanium;4-[bis(4-hydroxyphenyl)methyl]phenolate is sourced from PubChem (CID 153401488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).