C37H47NO11 — CID 153401515
2,6-bis[(4-hydroxy-3,5-dimethylphenyl)methyl]-4-methylphenolate;tetrakis(2-carboxyethyl)azanium (PubChem CID 153401515) has the molecular formula C37H47NO11 and a molecular weight of 681.78 g/mol. Its IUPAC name is 2,6-bis[(4-hydroxy-3,5-dimethylphenyl)methyl]-4-methylphenolate;tetrakis(2-carboxyethyl)azanium.
| Compound Name | 2,6-bis[(4-hydroxy-3,5-dimethylphenyl)methyl]-4-methylphenolate;tetrakis(2-carboxyethyl)azanium |
|---|---|
| PubChem CID | 153401515 |
| Molecular Formula | C37H47NO11 |
| Molecular Weight | 681.78 g/mol |
| Exact Mass | 681.31 |
| IUPAC Name | 2,6-bis[(4-hydroxy-3,5-dimethylphenyl)methyl]-4-methylphenolate;tetrakis(2-carboxyethyl)azanium |
| SMILES | Cc1cc(Cc2cc(C)c(O)c(C)c2)c([O-])c(Cc2cc(C)c(O)c(C)c2)c1.O=C(O)CC[N+](CCC(=O)O)(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C25H28O3.C12H19NO8/c1-14-6-21(12-19-8-15(2)23(26)16(3)9-19)25(28)22(7-14)13-20-10-17(4)24(27)18(5)11-20;14-9(15)1-5-13(6-2-10(16)17,7-3-11(18)19)8-4-12(20)21/h6-11,26-28H,12-13H2,1-5H3;1-8H2,(H3-,14,15,16,17,18,19,20,21) |
| InChIKey | LELMPXAJEKOPKU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 212.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.78 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|