About bis(3-aminopropyl) carbonate
bis(3-aminopropyl) carbonate (PubChem CID 15340171) has the molecular formula C7H16N2O3
and a molecular weight of 176.22 g/mol. Its IUPAC name is bis(3-aminopropyl) carbonate.
Molecular Properties
| Compound Name | bis(3-aminopropyl) carbonate |
| PubChem CID | 15340171 |
| Molecular Formula | C7H16N2O3 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | bis(3-aminopropyl) carbonate |
| SMILES | NCCCOC(=O)OCCCN |
| InChI | InChI=1S/C7H16N2O3/c8-3-1-5-11-7(10)12-6-2-4-9/h1-6,8-9H2 |
| InChIKey | XQIXLIYMTVKNMV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(3-aminopropyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-aminopropyl) carbonate?
The IUPAC name of bis(3-aminopropyl) carbonate (CID 15340171) is bis(3-aminopropyl) carbonate.
What is the SMILES notation for bis(3-aminopropyl) carbonate?
The canonical SMILES for bis(3-aminopropyl) carbonate is NCCCOC(=O)OCCCN.
What is the InChIKey of bis(3-aminopropyl) carbonate?
The InChIKey is XQIXLIYMTVKNMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O3/c8-3-1-5-11-7(10)12-6-2-4-9/h1-6,8-9H2.
What are the key properties of bis(3-aminopropyl) carbonate?
bis(3-aminopropyl) carbonate has a molecular weight of 176.22 g/mol, XLogP of -0.16, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-aminopropyl) carbonate is sourced from PubChem (CID 15340171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).