C19H23N5OS — CID 153402010
5-[[1-(5-methyl-2-pyridinyl)piperidin-3-yl]methoxy]-1H-2,1,3-benzothiadiazin-4-amine (PubChem CID 153402010) has the molecular formula C19H23N5OS and a molecular weight of 369.49 g/mol. Its IUPAC name is 5-[[1-(5-methyl-2-pyridinyl)piperidin-3-yl]methoxy]-1H-2,1,3-benzothiadiazin-4-amine.
| Compound Name | 5-[[1-(5-methyl-2-pyridinyl)piperidin-3-yl]methoxy]-1H-2,1,3-benzothiadiazin-4-amine |
|---|---|
| PubChem CID | 153402010 |
| Molecular Formula | C19H23N5OS |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 5-[[1-(5-methyl-2-pyridinyl)piperidin-3-yl]methoxy]-1H-2,1,3-benzothiadiazin-4-amine |
| SMILES | Cc1ccc(N2CCCC(COc3cccc4c3C(N)=NSN4)C2)nc1 |
| InChI | InChI=1S/C19H23N5OS/c1-13-7-8-17(21-10-13)24-9-3-4-14(11-24)12-25-16-6-2-5-15-18(16)19(20)23-26-22-15/h2,5-8,10,14,22H,3-4,9,11-12H2,1H3,(H2,20,23) |
| InChIKey | DUVBTLLDDQKNHQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|