C32H43N7O8 — CID 153402504
3-(hydroxymethyl)-1H-indole-2-carboxamide;methanamine;methyl 2-(butoxycarbonylamino)-3-[[2-[3-(4-methanimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate (PubChem CID 153402504) has the molecular formula C32H43N7O8 and a molecular weight of 653.74 g/mol. Its IUPAC name is 3-(hydroxymethyl)-1H-indole-2-carboxamide;methanamine;methyl 2-(butoxycarbonylamino)-3-[[2-[3-(4-methanimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate.
| Compound Name | 3-(hydroxymethyl)-1H-indole-2-carboxamide;methanamine;methyl 2-(butoxycarbonylamino)-3-[[2-[3-(4-methanimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 153402504 |
| Molecular Formula | C32H43N7O8 |
| Molecular Weight | 653.74 g/mol |
| Exact Mass | 653.32 |
| IUPAC Name | 3-(hydroxymethyl)-1H-indole-2-carboxamide;methanamine;methyl 2-(butoxycarbonylamino)-3-[[2-[3-(4-methanimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate |
| SMILES | CN.NC(=O)c1[nH]c2ccccc2c1CO.[H]/N=C/c1ccc(C2=NOC(CC(=O)NCC(NC(=O)OCCCC)C(=O)OC)C2)cc1 |
| InChI | InChI=1S/C21H28N4O6.C10H10N2O2.CH5N/c1-3-4-9-30-21(28)24-18(20(27)29-2)13-23-19(26)11-16-10-17(25-31-16)15-7-5-14(12-22)6-8-15;11-10(14)9-7(5-13)6-3-1-2-4-8(6)12-9;1-2/h5-8,12,16,18,22H,3-4,9-11,13H2,1-2H3,(H,23,26)(H,24,28);1-4,12-13H,5H2,(H2,11,14);2H2,1H3/b22-12+;; |
| InChIKey | LZRLLSPKYOYTOR-HYSBPSHESA-N |
| XLogP | 2.09 |
| TPSA | 244.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.74 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|