C30H36BrN7O7 — CID 153402526
3-bromo-1H-indole-2-carboxamide;methyl 2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate (PubChem CID 153402526) has the molecular formula C30H36BrN7O7 and a molecular weight of 686.56 g/mol. Its IUPAC name is 3-bromo-1H-indole-2-carboxamide;methyl 2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate.
| Compound Name | 3-bromo-1H-indole-2-carboxamide;methyl 2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 153402526 |
| Molecular Formula | C30H36BrN7O7 |
| Molecular Weight | 686.56 g/mol |
| Exact Mass | 685.19 |
| IUPAC Name | 3-bromo-1H-indole-2-carboxamide;methyl 2-(butoxycarbonylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate |
| SMILES | NC(=O)c1[nH]c2ccccc2c1Br.[H]/N=C(\N)c1ccc(C2=NOC(CC(=O)NCC(NC(=O)OCCCC)C(=O)OC)C2)cc1 |
| InChI | InChI=1S/C21H29N5O6.C9H7BrN2O/c1-3-4-9-31-21(29)25-17(20(28)30-2)12-24-18(27)11-15-10-16(26-32-15)13-5-7-14(8-6-13)19(22)23;10-7-5-3-1-2-4-6(5)12-8(7)9(11)13/h5-8,15,17H,3-4,9-12H2,1-2H3,(H3,22,23)(H,24,27)(H,25,29);1-4,12H,(H2,11,13) |
| InChIKey | KFMOZSVGUQDHTC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 224.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|