C28H25Cl2N3O7 — CID 153402577
4-[2,6-dichloro-4-[(3-hydroxyphenyl)methylcarbamoyl]phenyl]-4-oxobutanoic acid;3-(hydroxymethyl)-1H-indole-2-carboxamide (PubChem CID 153402577) has the molecular formula C28H25Cl2N3O7 and a molecular weight of 586.43 g/mol. Its IUPAC name is 4-[2,6-dichloro-4-[(3-hydroxyphenyl)methylcarbamoyl]phenyl]-4-oxobutanoic acid;3-(hydroxymethyl)-1H-indole-2-carboxamide.
| Compound Name | 4-[2,6-dichloro-4-[(3-hydroxyphenyl)methylcarbamoyl]phenyl]-4-oxobutanoic acid;3-(hydroxymethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 153402577 |
| Molecular Formula | C28H25Cl2N3O7 |
| Molecular Weight | 586.43 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | 4-[2,6-dichloro-4-[(3-hydroxyphenyl)methylcarbamoyl]phenyl]-4-oxobutanoic acid;3-(hydroxymethyl)-1H-indole-2-carboxamide |
| SMILES | NC(=O)c1[nH]c2ccccc2c1CO.O=C(O)CCC(=O)c1c(Cl)cc(C(=O)NCc2cccc(O)c2)cc1Cl |
| InChI | InChI=1S/C18H15Cl2NO5.C10H10N2O2/c19-13-7-11(8-14(20)17(13)15(23)4-5-16(24)25)18(26)21-9-10-2-1-3-12(22)6-10;11-10(14)9-7(5-13)6-3-1-2-4-8(6)12-9/h1-3,6-8,22H,4-5,9H2,(H,21,26)(H,24,25);1-4,12-13H,5H2,(H2,11,14) |
| InChIKey | YQJJKKVBOFNLCX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 182.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|