2-(2,2-dimethyl-5-nitro-6-oxo-3H-pyridin-1-yl)acetic acid

C9H12N2O5 — CID 153402907

IUPAC2-(2,2-dimethyl-5-nitro-6-oxo-3H-pyridin-1-yl)acetic acid
SMILESCC1(C)CC=C([N+](=O)[O-])C(=O)N1CC(=O)O
InChIInChI=1S/C9H12N2O5/c1-9(2)4-3-6(11(15)16)8(14)10(9)5-7(12)13/h3H,4-5H2,1-2H3,(H,12,13)
InChIKeyUQDOJFJMBWRGFZ-UHFFFAOYSA-N
MW228.20 g/mol
LogP0.24
Rot. Bonds3

About 2-(2,2-dimethyl-5-nitro-6-oxo-3H-pyridin-1-yl)acetic acid

2-(2,2-dimethyl-5-nitro-6-oxo-3H-pyridin-1-yl)acetic acid (PubChem CID 153402907) has the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. Its IUPAC name is 2-(2,2-dimethyl-5-nitro-6-oxo-3H-pyridin-1-yl)acetic acid.

Molecular Properties

Compound Name2-(2,2-dimethyl-5-nitro-6-oxo-3H-pyridin-1-yl)acetic acid
PubChem CID153402907
Molecular FormulaC9H12N2O5
Molecular Weight228.20 g/mol
Exact Mass228.07
IUPAC Name2-(2,2-dimethyl-5-nitro-6-oxo-3H-pyridin-1-yl)acetic acid
SMILESCC1(C)CC=C([N+](=O)[O-])C(=O)N1CC(=O)O
InChIInChI=1S/C9H12N2O5/c1-9(2)4-3-6(11(15)16)8(14)10(9)5-7(12)13/h3H,4-5H2,1-2H3,(H,12,13)
InChIKeyUQDOJFJMBWRGFZ-UHFFFAOYSA-N
XLogP0.24
TPSA100.75 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.20
LogP ≤ 50.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(2,2-dimethyl-5-nitro-6-oxo-3H-pyridin-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-dimethyl-5-nitro-6-oxo-3H-pyridin-1-yl)acetic acid?
The IUPAC name of 2-(2,2-dimethyl-5-nitro-6-oxo-3H-pyridin-1-yl)acetic acid (CID 153402907) is 2-(2,2-dimethyl-5-nitro-6-oxo-3H-pyridin-1-yl)acetic acid.
What is the SMILES notation for 2-(2,2-dimethyl-5-nitro-6-oxo-3H-pyridin-1-yl)acetic acid?
The canonical SMILES for 2-(2,2-dimethyl-5-nitro-6-oxo-3H-pyridin-1-yl)acetic acid is CC1(C)CC=C([N+](=O)[O-])C(=O)N1CC(=O)O.
What is the InChIKey of 2-(2,2-dimethyl-5-nitro-6-oxo-3H-pyridin-1-yl)acetic acid?
The InChIKey is UQDOJFJMBWRGFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O5/c1-9(2)4-3-6(11(15)16)8(14)10(9)5-7(12)13/h3H,4-5H2,1-2H3,(H,12,13).
What are the key properties of 2-(2,2-dimethyl-5-nitro-6-oxo-3H-pyridin-1-yl)acetic acid?
2-(2,2-dimethyl-5-nitro-6-oxo-3H-pyridin-1-yl)acetic acid has a molecular weight of 228.20 g/mol, XLogP of 0.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethyl-5-nitro-6-oxo-3H-pyridin-1-yl)acetic acid is sourced from PubChem (CID 153402907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).