About ethene;4-ethylheptane;4-[4-(methoxymethyl)phenyl]-3-methylbenzonitrile
ethene;4-ethylheptane;4-[4-(methoxymethyl)phenyl]-3-methylbenzonitrile (PubChem CID 153404183) has the molecular formula C27H39NO
and a molecular weight of 393.62 g/mol. Its IUPAC name is ethene;4-ethylheptane;4-[4-(methoxymethyl)phenyl]-3-methylbenzonitrile.
Molecular Properties
| Compound Name | ethene;4-ethylheptane;4-[4-(methoxymethyl)phenyl]-3-methylbenzonitrile |
| PubChem CID | 153404183 |
| Molecular Formula | C27H39NO |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 393.30 |
| IUPAC Name | ethene;4-ethylheptane;4-[4-(methoxymethyl)phenyl]-3-methylbenzonitrile |
| SMILES | C=C.CCCC(CC)CCC.COCc1ccc(-c2ccc(C#N)cc2C)cc1 |
| InChI | InChI=1S/C16H15NO.C9H20.C2H4/c1-12-9-14(10-17)5-8-16(12)15-6-3-13(4-7-15)11-18-2;1-4-7-9(6-3)8-5-2;1-2/h3-9H,11H2,1-2H3;9H,4-8H2,1-3H3;1-2H2 |
| InChIKey | QZXMWWJYADQBFJ-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;4-ethylheptane;4-[4-(methoxymethyl)phenyl]-3-methylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;4-ethylheptane;4-[4-(methoxymethyl)phenyl]-3-methylbenzonitrile?
The IUPAC name of ethene;4-ethylheptane;4-[4-(methoxymethyl)phenyl]-3-methylbenzonitrile (CID 153404183) is ethene;4-ethylheptane;4-[4-(methoxymethyl)phenyl]-3-methylbenzonitrile.
What is the SMILES notation for ethene;4-ethylheptane;4-[4-(methoxymethyl)phenyl]-3-methylbenzonitrile?
The canonical SMILES for ethene;4-ethylheptane;4-[4-(methoxymethyl)phenyl]-3-methylbenzonitrile is C=C.CCCC(CC)CCC.COCc1ccc(-c2ccc(C#N)cc2C)cc1.
What is the InChIKey of ethene;4-ethylheptane;4-[4-(methoxymethyl)phenyl]-3-methylbenzonitrile?
The InChIKey is QZXMWWJYADQBFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO.C9H20.C2H4/c1-12-9-14(10-17)5-8-16(12)15-6-3-13(4-7-15)11-18-2;1-4-7-9(6-3)8-5-2;1-2/h3-9H,11H2,1-2H3;9H,4-8H2,1-3H3;1-2H2.
What are the key properties of ethene;4-ethylheptane;4-[4-(methoxymethyl)phenyl]-3-methylbenzonitrile?
ethene;4-ethylheptane;4-[4-(methoxymethyl)phenyl]-3-methylbenzonitrile has a molecular weight of 393.62 g/mol, XLogP of 8.10, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;4-ethylheptane;4-[4-(methoxymethyl)phenyl]-3-methylbenzonitrile is sourced from PubChem (CID 153404183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).