C15H14ClN4O3+ — CID 153404243
methyl 2-[5-[(6-chloro-3-pyridinyl)methyl]-2-oxo-3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-1-yl]acetate (PubChem CID 153404243) has the molecular formula C15H14ClN4O3+ and a molecular weight of 333.76 g/mol. Its IUPAC name is methyl 2-[5-[(6-chloro-3-pyridinyl)methyl]-2-oxo-3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-1-yl]acetate.
| Compound Name | methyl 2-[5-[(6-chloro-3-pyridinyl)methyl]-2-oxo-3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-1-yl]acetate |
|---|---|
| PubChem CID | 153404243 |
| Molecular Formula | C15H14ClN4O3+ |
| Molecular Weight | 333.76 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | methyl 2-[5-[(6-chloro-3-pyridinyl)methyl]-2-oxo-3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-1-yl]acetate |
| SMILES | COC(=O)Cn1c(=O)[nH][n+]2c(Cc3ccc(Cl)nc3)cccc12 |
| InChI | InChI=1S/C15H13ClN4O3/c1-23-14(21)9-19-13-4-2-3-11(20(13)18-15(19)22)7-10-5-6-12(16)17-8-10/h2-6,8H,7,9H2,1H3/p+1 |
| InChIKey | GZFHCDDGKZYAAI-UHFFFAOYSA-O |
| XLogP | 0.73 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.76 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|