C15H16ClN4O3S+ — CID 153404245
5-[(6-chloro-3-pyridinyl)methyl]-1-(2-methylsulfonylethyl)-3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-2-one (PubChem CID 153404245) has the molecular formula C15H16ClN4O3S+ and a molecular weight of 367.84 g/mol. Its IUPAC name is 5-[(6-chloro-3-pyridinyl)methyl]-1-(2-methylsulfonylethyl)-3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-2-one.
| Compound Name | 5-[(6-chloro-3-pyridinyl)methyl]-1-(2-methylsulfonylethyl)-3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-2-one |
|---|---|
| PubChem CID | 153404245 |
| Molecular Formula | C15H16ClN4O3S+ |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 5-[(6-chloro-3-pyridinyl)methyl]-1-(2-methylsulfonylethyl)-3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-2-one |
| SMILES | CS(=O)(=O)CCn1c(=O)[nH][n+]2c(Cc3ccc(Cl)nc3)cccc12 |
| InChI | InChI=1S/C15H15ClN4O3S/c1-24(22,23)8-7-19-14-4-2-3-12(20(14)18-15(19)21)9-11-5-6-13(16)17-10-11/h2-6,10H,7-9H2,1H3/p+1 |
| InChIKey | PXJWJYUVEGPZNJ-UHFFFAOYSA-O |
| XLogP | 0.60 |
| TPSA | 88.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|