About 2-cyclohexyl-5-(methoxymethyl)-1,3,4-oxadiazole;ethane
2-cyclohexyl-5-(methoxymethyl)-1,3,4-oxadiazole;ethane (PubChem CID 153404774) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-cyclohexyl-5-(methoxymethyl)-1,3,4-oxadiazole;ethane.
Molecular Properties
| Compound Name | 2-cyclohexyl-5-(methoxymethyl)-1,3,4-oxadiazole;ethane |
| PubChem CID | 153404774 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 2-cyclohexyl-5-(methoxymethyl)-1,3,4-oxadiazole;ethane |
| SMILES | CC.COCc1nnc(C2CCCCC2)o1 |
| InChI | InChI=1S/C10H16N2O2.C2H6/c1-13-7-9-11-12-10(14-9)8-5-3-2-4-6-8;1-2/h8H,2-7H2,1H3;1-2H3 |
| InChIKey | XBBFZZVSCOPEFG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclohexyl-5-(methoxymethyl)-1,3,4-oxadiazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-5-(methoxymethyl)-1,3,4-oxadiazole;ethane?
The IUPAC name of 2-cyclohexyl-5-(methoxymethyl)-1,3,4-oxadiazole;ethane (CID 153404774) is 2-cyclohexyl-5-(methoxymethyl)-1,3,4-oxadiazole;ethane.
What is the SMILES notation for 2-cyclohexyl-5-(methoxymethyl)-1,3,4-oxadiazole;ethane?
The canonical SMILES for 2-cyclohexyl-5-(methoxymethyl)-1,3,4-oxadiazole;ethane is CC.COCc1nnc(C2CCCCC2)o1.
What is the InChIKey of 2-cyclohexyl-5-(methoxymethyl)-1,3,4-oxadiazole;ethane?
The InChIKey is XBBFZZVSCOPEFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2.C2H6/c1-13-7-9-11-12-10(14-9)8-5-3-2-4-6-8;1-2/h8H,2-7H2,1H3;1-2H3.
What are the key properties of 2-cyclohexyl-5-(methoxymethyl)-1,3,4-oxadiazole;ethane?
2-cyclohexyl-5-(methoxymethyl)-1,3,4-oxadiazole;ethane has a molecular weight of 226.32 g/mol, XLogP of 3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-5-(methoxymethyl)-1,3,4-oxadiazole;ethane is sourced from PubChem (CID 153404774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).