C3H7F2N3 — CID 153404781
(Z)-3,3-difluoro-1-hydrazinylprop-1-en-2-amine (PubChem CID 153404781) has the molecular formula C3H7F2N3 and a molecular weight of 123.11 g/mol. Its IUPAC name is (Z)-3,3-difluoro-1-hydrazinylprop-1-en-2-amine.
| Compound Name | (Z)-3,3-difluoro-1-hydrazinylprop-1-en-2-amine |
|---|---|
| PubChem CID | 153404781 |
| Molecular Formula | C3H7F2N3 |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.06 |
| IUPAC Name | (Z)-3,3-difluoro-1-hydrazinylprop-1-en-2-amine |
| SMILES | NN/C=C(\N)C(F)F |
| InChI | InChI=1S/C3H7F2N3/c4-3(5)2(6)1-8-7/h1,3,8H,6-7H2/b2-1- |
| InChIKey | YNACMMROYUVESJ-UPHRSURJSA-N |
| XLogP | -0.49 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|