About 2-bromo-N-propan-2-yl-5-(1,3,4-thiadiazol-2-yl)pyridin-4-amine;methyl cyclobutanecarboxylate
2-bromo-N-propan-2-yl-5-(1,3,4-thiadiazol-2-yl)pyridin-4-amine;methyl cyclobutanecarboxylate (PubChem CID 153404962) has the molecular formula C16H21BrN4O2S
and a molecular weight of 413.34 g/mol. Its IUPAC name is 2-bromo-N-propan-2-yl-5-(1,3,4-thiadiazol-2-yl)pyridin-4-amine;methyl cyclobutanecarboxylate.
Molecular Properties
| Compound Name | 2-bromo-N-propan-2-yl-5-(1,3,4-thiadiazol-2-yl)pyridin-4-amine;methyl cyclobutanecarboxylate |
| PubChem CID | 153404962 |
| Molecular Formula | C16H21BrN4O2S |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 2-bromo-N-propan-2-yl-5-(1,3,4-thiadiazol-2-yl)pyridin-4-amine;methyl cyclobutanecarboxylate |
| SMILES | CC(C)Nc1cc(Br)ncc1-c1nncs1.COC(=O)C1CCC1 |
| InChI | InChI=1S/C10H11BrN4S.C6H10O2/c1-6(2)14-8-3-9(11)12-4-7(8)10-15-13-5-16-10;1-8-6(7)5-3-2-4-5/h3-6H,1-2H3,(H,12,14);5H,2-4H2,1H3 |
| InChIKey | KGKVTKADUGQCMX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-propan-2-yl-5-(1,3,4-thiadiazol-2-yl)pyridin-4-amine;methyl cyclobutanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-propan-2-yl-5-(1,3,4-thiadiazol-2-yl)pyridin-4-amine;methyl cyclobutanecarboxylate?
The IUPAC name of 2-bromo-N-propan-2-yl-5-(1,3,4-thiadiazol-2-yl)pyridin-4-amine;methyl cyclobutanecarboxylate (CID 153404962) is 2-bromo-N-propan-2-yl-5-(1,3,4-thiadiazol-2-yl)pyridin-4-amine;methyl cyclobutanecarboxylate.
What is the SMILES notation for 2-bromo-N-propan-2-yl-5-(1,3,4-thiadiazol-2-yl)pyridin-4-amine;methyl cyclobutanecarboxylate?
The canonical SMILES for 2-bromo-N-propan-2-yl-5-(1,3,4-thiadiazol-2-yl)pyridin-4-amine;methyl cyclobutanecarboxylate is CC(C)Nc1cc(Br)ncc1-c1nncs1.COC(=O)C1CCC1.
What is the InChIKey of 2-bromo-N-propan-2-yl-5-(1,3,4-thiadiazol-2-yl)pyridin-4-amine;methyl cyclobutanecarboxylate?
The InChIKey is KGKVTKADUGQCMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN4S.C6H10O2/c1-6(2)14-8-3-9(11)12-4-7(8)10-15-13-5-16-10;1-8-6(7)5-3-2-4-5/h3-6H,1-2H3,(H,12,14);5H,2-4H2,1H3.
What are the key properties of 2-bromo-N-propan-2-yl-5-(1,3,4-thiadiazol-2-yl)pyridin-4-amine;methyl cyclobutanecarboxylate?
2-bromo-N-propan-2-yl-5-(1,3,4-thiadiazol-2-yl)pyridin-4-amine;methyl cyclobutanecarboxylate has a molecular weight of 413.34 g/mol, XLogP of 4.14, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-propan-2-yl-5-(1,3,4-thiadiazol-2-yl)pyridin-4-amine;methyl cyclobutanecarboxylate is sourced from PubChem (CID 153404962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).