About N-[1-(5-bromo-1,3,4-thiadiazol-2-yl)piperidin-4-yl]acetamide;ethane
N-[1-(5-bromo-1,3,4-thiadiazol-2-yl)piperidin-4-yl]acetamide;ethane (PubChem CID 153404964) has the molecular formula C11H19BrN4OS
and a molecular weight of 335.27 g/mol. Its IUPAC name is N-[1-(5-bromo-1,3,4-thiadiazol-2-yl)piperidin-4-yl]acetamide;ethane.
Molecular Properties
| Compound Name | N-[1-(5-bromo-1,3,4-thiadiazol-2-yl)piperidin-4-yl]acetamide;ethane |
| PubChem CID | 153404964 |
| Molecular Formula | C11H19BrN4OS |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | N-[1-(5-bromo-1,3,4-thiadiazol-2-yl)piperidin-4-yl]acetamide;ethane |
| SMILES | CC.CC(=O)NC1CCN(c2nnc(Br)s2)CC1 |
| InChI | InChI=1S/C9H13BrN4OS.C2H6/c1-6(15)11-7-2-4-14(5-3-7)9-13-12-8(10)16-9;1-2/h7H,2-5H2,1H3,(H,11,15);1-2H3 |
| InChIKey | YIFYYHHGNJXXPO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-(5-bromo-1,3,4-thiadiazol-2-yl)piperidin-4-yl]acetamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(5-bromo-1,3,4-thiadiazol-2-yl)piperidin-4-yl]acetamide;ethane?
The IUPAC name of N-[1-(5-bromo-1,3,4-thiadiazol-2-yl)piperidin-4-yl]acetamide;ethane (CID 153404964) is N-[1-(5-bromo-1,3,4-thiadiazol-2-yl)piperidin-4-yl]acetamide;ethane.
What is the SMILES notation for N-[1-(5-bromo-1,3,4-thiadiazol-2-yl)piperidin-4-yl]acetamide;ethane?
The canonical SMILES for N-[1-(5-bromo-1,3,4-thiadiazol-2-yl)piperidin-4-yl]acetamide;ethane is CC.CC(=O)NC1CCN(c2nnc(Br)s2)CC1.
What is the InChIKey of N-[1-(5-bromo-1,3,4-thiadiazol-2-yl)piperidin-4-yl]acetamide;ethane?
The InChIKey is YIFYYHHGNJXXPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BrN4OS.C2H6/c1-6(15)11-7-2-4-14(5-3-7)9-13-12-8(10)16-9;1-2/h7H,2-5H2,1H3,(H,11,15);1-2H3.
What are the key properties of N-[1-(5-bromo-1,3,4-thiadiazol-2-yl)piperidin-4-yl]acetamide;ethane?
N-[1-(5-bromo-1,3,4-thiadiazol-2-yl)piperidin-4-yl]acetamide;ethane has a molecular weight of 335.27 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(5-bromo-1,3,4-thiadiazol-2-yl)piperidin-4-yl]acetamide;ethane is sourced from PubChem (CID 153404964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).