C18H16Cl2N2O2 — CID 153405435
3-chloro-4-[(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-hydroxymethyl]phenol (PubChem CID 153405435) has the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.24 g/mol. Its IUPAC name is 3-chloro-4-[(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-hydroxymethyl]phenol.
| Compound Name | 3-chloro-4-[(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-hydroxymethyl]phenol |
|---|---|
| PubChem CID | 153405435 |
| Molecular Formula | C18H16Cl2N2O2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 3-chloro-4-[(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-hydroxymethyl]phenol |
| SMILES | Oc1ccc(C(O)N2CCc3c([nH]c4ccc(Cl)cc34)C2)c(Cl)c1 |
| InChI | InChI=1S/C18H16Cl2N2O2/c19-10-1-4-16-14(7-10)12-5-6-22(9-17(12)21-16)18(24)13-3-2-11(23)8-15(13)20/h1-4,7-8,18,21,23-24H,5-6,9H2 |
| InChIKey | CYSGISGHNACUIZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|