About (3R)-1-butyl-3-(phenoxy)pyrrolidine;uranium
(3R)-1-butyl-3-(phenoxy)pyrrolidine;uranium (PubChem CID 153405641) has the molecular formula C14H20NOU-
and a molecular weight of 456.35 g/mol. Its IUPAC name is (3R)-1-butyl-3-(phenoxy)pyrrolidine;uranium.
Molecular Properties
| Compound Name | (3R)-1-butyl-3-(phenoxy)pyrrolidine;uranium |
| PubChem CID | 153405641 |
| Molecular Formula | C14H20NOU- |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | (3R)-1-butyl-3-(phenoxy)pyrrolidine;uranium |
| SMILES | CCCCN1CC[C@@H](Oc2cc[c-]cc2)C1.[U] |
| InChI | InChI=1S/C14H20NO.U/c1-2-3-10-15-11-9-14(12-15)16-13-7-5-4-6-8-13;/h5-8,14H,2-3,9-12H2,1H3;/q-1;/t14-;/m1./s1 |
| InChIKey | HHHICPXFVPGWEP-PFEQFJNWSA-N |
| XLogP | 2.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1-butyl-3-(phenoxy)pyrrolidine;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-butyl-3-(phenoxy)pyrrolidine;uranium?
The IUPAC name of (3R)-1-butyl-3-(phenoxy)pyrrolidine;uranium (CID 153405641) is (3R)-1-butyl-3-(phenoxy)pyrrolidine;uranium.
What is the SMILES notation for (3R)-1-butyl-3-(phenoxy)pyrrolidine;uranium?
The canonical SMILES for (3R)-1-butyl-3-(phenoxy)pyrrolidine;uranium is CCCCN1CC[C@@H](Oc2cc[c-]cc2)C1.[U].
What is the InChIKey of (3R)-1-butyl-3-(phenoxy)pyrrolidine;uranium?
The InChIKey is HHHICPXFVPGWEP-PFEQFJNWSA-N. The full InChI is InChI=1S/C14H20NO.U/c1-2-3-10-15-11-9-14(12-15)16-13-7-5-4-6-8-13;/h5-8,14H,2-3,9-12H2,1H3;/q-1;/t14-;/m1./s1.
What are the key properties of (3R)-1-butyl-3-(phenoxy)pyrrolidine;uranium?
(3R)-1-butyl-3-(phenoxy)pyrrolidine;uranium has a molecular weight of 456.35 g/mol, XLogP of 2.74, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-butyl-3-(phenoxy)pyrrolidine;uranium is sourced from PubChem (CID 153405641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).