C52H66OSi — CID 153406054
[6-tert-butyl-4-(3,5-ditert-butylphenyl)-5-methoxy-2-methyl-1H-inden-1-yl]-[4-(3,5-dimethylphenyl)-2-methyl-1,5,6,7-tetrahydro-s-indacen-1-yl]-dimethylsilane (PubChem CID 153406054) has the molecular formula C52H66OSi and a molecular weight of 735.18 g/mol. Its IUPAC name is [6-tert-butyl-4-(3,5-ditert-butylphenyl)-5-methoxy-2-methyl-1H-inden-1-yl]-[4-(3,5-dimethylphenyl)-2-methyl-1,5,6,7-tetrahydro-s-indacen-1-yl]-dimethylsilane.
| Compound Name | [6-tert-butyl-4-(3,5-ditert-butylphenyl)-5-methoxy-2-methyl-1H-inden-1-yl]-[4-(3,5-dimethylphenyl)-2-methyl-1,5,6,7-tetrahydro-s-indacen-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 153406054 |
| Molecular Formula | C52H66OSi |
| Molecular Weight | 735.18 g/mol |
| Exact Mass | 734.49 |
| IUPAC Name | [6-tert-butyl-4-(3,5-ditert-butylphenyl)-5-methoxy-2-methyl-1H-inden-1-yl]-[4-(3,5-dimethylphenyl)-2-methyl-1,5,6,7-tetrahydro-s-indacen-1-yl]-dimethylsilane |
| SMILES | COc1c(C(C)(C)C)cc2c(c1-c1cc(C(C)(C)C)cc(C(C)(C)C)c1)C=C(C)C2[Si](C)(C)C1C(C)=Cc2c1cc1c(c2-c2cc(C)cc(C)c2)CCC1 |
| InChI | InChI=1S/C52H66OSi/c1-30-20-31(2)22-35(21-30)45-39-19-17-18-34(39)27-42-40(45)23-32(3)48(42)54(15,16)49-33(4)24-41-43(49)29-44(52(11,12)13)47(53-14)46(41)36-25-37(50(5,6)7)28-38(26-36)51(8,9)10/h20-29,48-49H,17-19H2,1-16H3 |
| InChIKey | FNSNGNFRUWYLQS-UHFFFAOYSA-N |
| XLogP | 14.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.18 |
| LogP ≤ 5 | 14.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|