About N-[2-(2,3-dihydro-1H-benzo[f]chromen-10-yl)ethyl]acetamide
N-[2-(2,3-dihydro-1H-benzo[f]chromen-10-yl)ethyl]acetamide (PubChem CID 15340633) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-benzo[f]chromen-10-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-(2,3-dihydro-1H-benzo[f]chromen-10-yl)ethyl]acetamide |
| PubChem CID | 15340633 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-benzo[f]chromen-10-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCc1cccc2ccc3c(c12)CCCO3 |
| InChI | InChI=1S/C17H19NO2/c1-12(19)18-10-9-14-5-2-4-13-7-8-16-15(17(13)14)6-3-11-20-16/h2,4-5,7-8H,3,6,9-11H2,1H3,(H,18,19) |
| InChIKey | NMWLOKCBICPAGP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(2,3-dihydro-1H-benzo[f]chromen-10-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,3-dihydro-1H-benzo[f]chromen-10-yl)ethyl]acetamide?
The IUPAC name of N-[2-(2,3-dihydro-1H-benzo[f]chromen-10-yl)ethyl]acetamide (CID 15340633) is N-[2-(2,3-dihydro-1H-benzo[f]chromen-10-yl)ethyl]acetamide.
What is the SMILES notation for N-[2-(2,3-dihydro-1H-benzo[f]chromen-10-yl)ethyl]acetamide?
The canonical SMILES for N-[2-(2,3-dihydro-1H-benzo[f]chromen-10-yl)ethyl]acetamide is CC(=O)NCCc1cccc2ccc3c(c12)CCCO3.
What is the InChIKey of N-[2-(2,3-dihydro-1H-benzo[f]chromen-10-yl)ethyl]acetamide?
The InChIKey is NMWLOKCBICPAGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-12(19)18-10-9-14-5-2-4-13-7-8-16-15(17(13)14)6-3-11-20-16/h2,4-5,7-8H,3,6,9-11H2,1H3,(H,18,19).
What are the key properties of N-[2-(2,3-dihydro-1H-benzo[f]chromen-10-yl)ethyl]acetamide?
N-[2-(2,3-dihydro-1H-benzo[f]chromen-10-yl)ethyl]acetamide has a molecular weight of 269.34 g/mol, XLogP of 2.84, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,3-dihydro-1H-benzo[f]chromen-10-yl)ethyl]acetamide is sourced from PubChem (CID 15340633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).