C16H17NO2 — CID 153406501
6-methoxy-8-phenyl-1,2,3,4-tetrahydroisoquinolin-7-ol (PubChem CID 153406501) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 6-methoxy-8-phenyl-1,2,3,4-tetrahydroisoquinolin-7-ol.
| Compound Name | 6-methoxy-8-phenyl-1,2,3,4-tetrahydroisoquinolin-7-ol |
|---|---|
| PubChem CID | 153406501 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 6-methoxy-8-phenyl-1,2,3,4-tetrahydroisoquinolin-7-ol |
| SMILES | COc1cc2c(c(-c3ccccc3)c1O)CNCC2 |
| InChI | InChI=1S/C16H17NO2/c1-19-14-9-12-7-8-17-10-13(12)15(16(14)18)11-5-3-2-4-6-11/h2-6,9,17-18H,7-8,10H2,1H3 |
| InChIKey | ZWMVHCIAJQPKGB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |