C19H16ClNSe — CID 153406927
3-[2-(4-chlorophenyl)phenyl]-4,5,6,7-tetrahydro-1,2-benzoselenazole (PubChem CID 153406927) has the molecular formula C19H16ClNSe and a molecular weight of 372.76 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)phenyl]-4,5,6,7-tetrahydro-1,2-benzoselenazole.
| Compound Name | 3-[2-(4-chlorophenyl)phenyl]-4,5,6,7-tetrahydro-1,2-benzoselenazole |
|---|---|
| PubChem CID | 153406927 |
| Molecular Formula | C19H16ClNSe |
| Molecular Weight | 372.76 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 3-[2-(4-chlorophenyl)phenyl]-4,5,6,7-tetrahydro-1,2-benzoselenazole |
| SMILES | Clc1ccc(-c2ccccc2-c2n[se]c3c2CCCC3)cc1 |
| InChI | InChI=1S/C19H16ClNSe/c20-14-11-9-13(10-12-14)15-5-1-2-6-16(15)19-17-7-3-4-8-18(17)22-21-19/h1-2,5-6,9-12H,3-4,7-8H2 |
| InChIKey | MMHRYNJYARPFGJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.76 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|