About 4-(4-methoxyphenyl)-2,3-dimethylselenophene
4-(4-methoxyphenyl)-2,3-dimethylselenophene (PubChem CID 153406978) has the molecular formula C13H14OSe
and a molecular weight of 265.21 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2,3-dimethylselenophene.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-2,3-dimethylselenophene |
| PubChem CID | 153406978 |
| Molecular Formula | C13H14OSe |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 4-(4-methoxyphenyl)-2,3-dimethylselenophene |
| SMILES | COc1ccc(-c2c[se]c(C)c2C)cc1 |
| InChI | InChI=1S/C13H14OSe/c1-9-10(2)15-8-13(9)11-4-6-12(14-3)7-5-11/h4-8H,1-3H3 |
| InChIKey | WLBFUKBVSWPNBI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methoxyphenyl)-2,3-dimethylselenophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-2,3-dimethylselenophene?
The IUPAC name of 4-(4-methoxyphenyl)-2,3-dimethylselenophene (CID 153406978) is 4-(4-methoxyphenyl)-2,3-dimethylselenophene.
What is the SMILES notation for 4-(4-methoxyphenyl)-2,3-dimethylselenophene?
The canonical SMILES for 4-(4-methoxyphenyl)-2,3-dimethylselenophene is COc1ccc(-c2c[se]c(C)c2C)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-2,3-dimethylselenophene?
The InChIKey is WLBFUKBVSWPNBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14OSe/c1-9-10(2)15-8-13(9)11-4-6-12(14-3)7-5-11/h4-8H,1-3H3.
What are the key properties of 4-(4-methoxyphenyl)-2,3-dimethylselenophene?
4-(4-methoxyphenyl)-2,3-dimethylselenophene has a molecular weight of 265.21 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-2,3-dimethylselenophene is sourced from PubChem (CID 153406978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).