C19H25NO — CID 15340758
4,4,6-trimethyl-2-(1-naphthalen-1-ylethyl)-1,3-oxazinane (PubChem CID 15340758) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is 4,4,6-trimethyl-2-(1-naphthalen-1-ylethyl)-1,3-oxazinane.
| Compound Name | 4,4,6-trimethyl-2-(1-naphthalen-1-ylethyl)-1,3-oxazinane |
|---|---|
| PubChem CID | 15340758 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 4,4,6-trimethyl-2-(1-naphthalen-1-ylethyl)-1,3-oxazinane |
| SMILES | CC1CC(C)(C)NC(C(C)c2cccc3ccccc23)O1 |
| InChI | InChI=1S/C19H25NO/c1-13-12-19(3,4)20-18(21-13)14(2)16-11-7-9-15-8-5-6-10-17(15)16/h5-11,13-14,18,20H,12H2,1-4H3 |
| InChIKey | PEFQZDSFVKNMSH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |