C19H26F3N5S — CID 15340811
5-[6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexyl]-1,3,4-thiadiazol-2-amine (PubChem CID 15340811) has the molecular formula C19H26F3N5S and a molecular weight of 413.51 g/mol. Its IUPAC name is 5-[6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 15340811 |
| Molecular Formula | C19H26F3N5S |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 5-[6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(CCCCCCN2CCN(c3cccc(C(F)(F)F)c3)CC2)s1 |
| InChI | InChI=1S/C19H26F3N5S/c20-19(21,22)15-6-5-7-16(14-15)27-12-10-26(11-13-27)9-4-2-1-3-8-17-24-25-18(23)28-17/h5-7,14H,1-4,8-13H2,(H2,23,25) |
| InChIKey | ADNIKIJPTLYHER-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|