C23H36N4O4Si — CID 153408296
methyl 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(phenylmethoxyamino)-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridine-7-carboxylate (PubChem CID 153408296) has the molecular formula C23H36N4O4Si and a molecular weight of 460.65 g/mol. Its IUPAC name is methyl 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(phenylmethoxyamino)-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridine-7-carboxylate.
| Compound Name | methyl 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(phenylmethoxyamino)-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 153408296 |
| Molecular Formula | C23H36N4O4Si |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | methyl 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(phenylmethoxyamino)-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridine-7-carboxylate |
| SMILES | COC(=O)C1NCC(NOCc2ccccc2)c2cnn(CCO[Si](C)(C)C(C)(C)C)c21 |
| InChI | InChI=1S/C23H36N4O4Si/c1-23(2,3)32(5,6)31-13-12-27-21-18(14-25-27)19(15-24-20(21)22(28)29-4)26-30-16-17-10-8-7-9-11-17/h7-11,14,19-20,24,26H,12-13,15-16H2,1-6H3 |
| InChIKey | IWPCQGPCMBPBPB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|