About (2-naphthalen-1-ylphenyl) [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonate
(2-naphthalen-1-ylphenyl) [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonate (PubChem CID 153408340) has the molecular formula C24H16O4
and a molecular weight of 368.39 g/mol. Its IUPAC name is (2-naphthalen-1-ylphenyl) [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonate.
Molecular Properties
| Compound Name | (2-naphthalen-1-ylphenyl) [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonate |
| PubChem CID | 153408340 |
| Molecular Formula | C24H16O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (2-naphthalen-1-ylphenyl) [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonate |
| SMILES | O=C=C1C=CC=CC1OC(=O)Oc1ccccc1-c1cccc2ccccc12 |
| InChI | InChI=1S/C24H16O4/c25-16-18-9-2-5-14-22(18)27-24(26)28-23-15-6-4-12-21(23)20-13-7-10-17-8-1-3-11-19(17)20/h1-15,22H |
| InChIKey | SFMXMMJUUKPPNE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (2-naphthalen-1-ylphenyl) [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-naphthalen-1-ylphenyl) [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonate?
The IUPAC name of (2-naphthalen-1-ylphenyl) [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonate (CID 153408340) is (2-naphthalen-1-ylphenyl) [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonate.
What is the SMILES notation for (2-naphthalen-1-ylphenyl) [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonate?
The canonical SMILES for (2-naphthalen-1-ylphenyl) [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonate is O=C=C1C=CC=CC1OC(=O)Oc1ccccc1-c1cccc2ccccc12.
What is the InChIKey of (2-naphthalen-1-ylphenyl) [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonate?
The InChIKey is SFMXMMJUUKPPNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16O4/c25-16-18-9-2-5-14-22(18)27-24(26)28-23-15-6-4-12-21(23)20-13-7-10-17-8-1-3-11-19(17)20/h1-15,22H.
What are the key properties of (2-naphthalen-1-ylphenyl) [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonate?
(2-naphthalen-1-ylphenyl) [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonate has a molecular weight of 368.39 g/mol, XLogP of 5.27, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-naphthalen-1-ylphenyl) [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonate is sourced from PubChem (CID 153408340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).