C60H76F2N2O6S4 — CID 153408882
5,10-bis(3-ethylhexyl)-3,8-difluoro-2,7-bis[5-[5-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]thiophen-2-yl]thiophen-2-yl]indolo[3,2-b]indole (PubChem CID 153408882) has the molecular formula C60H76F2N2O6S4 and a molecular weight of 1087.54 g/mol. Its IUPAC name is 5,10-bis(3-ethylhexyl)-3,8-difluoro-2,7-bis[5-[5-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]thiophen-2-yl]thiophen-2-yl]indolo[3,2-b]indole.
| Compound Name | 5,10-bis(3-ethylhexyl)-3,8-difluoro-2,7-bis[5-[5-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]thiophen-2-yl]thiophen-2-yl]indolo[3,2-b]indole |
|---|---|
| PubChem CID | 153408882 |
| Molecular Formula | C60H76F2N2O6S4 |
| Molecular Weight | 1087.54 g/mol |
| Exact Mass | 1086.46 |
| IUPAC Name | 5,10-bis(3-ethylhexyl)-3,8-difluoro-2,7-bis[5-[5-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]thiophen-2-yl]thiophen-2-yl]indolo[3,2-b]indole |
| SMILES | CCCC(CC)CCn1c2cc(-c3ccc(-c4ccc(CCOCCOCCOC)s4)s3)c(F)cc2c2c1c1cc(F)c(-c3ccc(-c4ccc(CCOCCOCCOC)s4)s3)cc1n2CCC(CC)CCC |
| InChI | InChI=1S/C60H76F2N2O6S4/c1-7-11-41(9-3)21-25-63-51-39-45(53-17-19-57(73-53)55-15-13-43(71-55)23-27-67-33-35-69-31-29-65-5)49(61)37-47(51)60-59(63)48-38-50(62)46(40-52(48)64(60)26-22-42(10-4)12-8-2)54-18-20-58(74-54)56-16-14-44(72-56)24-28-68-34-36-70-32-30-66-6/h13-20,37-42H,7-12,21-36H2,1-6H3 |
| InChIKey | CVQFJCJXVXWKEM-UHFFFAOYSA-N |
| XLogP | 16.82 |
| TPSA | 65.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1087.54 |
| LogP ≤ 5 | 16.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|