C30H38N4O2 — CID 153409026
2-tert-butyl-4-[4-[(2-tert-butyl-5,6,7,8-tetrahydroquinazolin-4-yl)oxy]phenoxy]-5,6,7,8-tetrahydroquinazoline (PubChem CID 153409026) has the molecular formula C30H38N4O2 and a molecular weight of 486.66 g/mol. Its IUPAC name is 2-tert-butyl-4-[4-[(2-tert-butyl-5,6,7,8-tetrahydroquinazolin-4-yl)oxy]phenoxy]-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 2-tert-butyl-4-[4-[(2-tert-butyl-5,6,7,8-tetrahydroquinazolin-4-yl)oxy]phenoxy]-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 153409026 |
| Molecular Formula | C30H38N4O2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 2-tert-butyl-4-[4-[(2-tert-butyl-5,6,7,8-tetrahydroquinazolin-4-yl)oxy]phenoxy]-5,6,7,8-tetrahydroquinazoline |
| SMILES | CC(C)(C)c1nc2c(c(Oc3ccc(Oc4nc(C(C)(C)C)nc5c4CCCC5)cc3)n1)CCCC2 |
| InChI | InChI=1S/C30H38N4O2/c1-29(2,3)27-31-23-13-9-7-11-21(23)25(33-27)35-19-15-17-20(18-16-19)36-26-22-12-8-10-14-24(22)32-28(34-26)30(4,5)6/h15-18H,7-14H2,1-6H3 |
| InChIKey | WDAVXYXEFUZUHV-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |